C22H23N5O3S — CID 55383580
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide (PubChem CID 55383580) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55383580 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H23N5O3S/c1-14(16-8-7-15-5-3-4-6-17(15)11-16)24-21(28)18-9-10-20(19(12-18)27(29)30)31-22-25-23-13-26(22)2/h7-14H,3-6H2,1-2H3,(H,24,28) |
| InChIKey | PFHQHENMWDFEFM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|