C17H21N5O3S — CID 51145615
azocan-1-yl-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone (PubChem CID 51145615) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is azocan-1-yl-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone.
| Compound Name | azocan-1-yl-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 51145615 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | azocan-1-yl-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)N2CCCCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O3S/c1-20-12-18-19-17(20)26-15-8-7-13(11-14(15)22(24)25)16(23)21-9-5-3-2-4-6-10-21/h7-8,11-12H,2-6,9-10H2,1H3 |
| InChIKey | CQDZPSNFSXJFBJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|