C21H22N6O3S — CID 42930552
(2-cyclohexylimino-1-pyridinyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone (PubChem CID 42930552) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is (2-cyclohexylimino-1-pyridinyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone.
| Compound Name | (2-cyclohexylimino-1-pyridinyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 42930552 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2-cyclohexylimino-1-pyridinyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)n2cccc/c2=N\C2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N6O3S/c1-25-14-22-24-21(25)31-18-11-10-15(13-17(18)27(29)30)20(28)26-12-6-5-9-19(26)23-16-7-3-2-4-8-16/h5-6,9-14,16H,2-4,7-8H2,1H3/b23-19+ |
| InChIKey | ZXSYTRHDLYPJLU-FCDQGJHFSA-N |
| XLogP | 3.60 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|