C21H18N8O3S — CID 16962964
(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone (PubChem CID 16962964) has the molecular formula C21H18N8O3S and a molecular weight of 462.50 g/mol. Its IUPAC name is (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone.
| Compound Name | (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 16962964 |
| Molecular Formula | C21H18N8O3S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
| SMILES | CN1CCN(C(=O)c2ccc(Sc3nncn3C)c([N+](=O)[O-])c2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H18N8O3S/c1-26-9-10-28(19-18(26)23-14-5-3-4-6-15(14)24-19)20(30)13-7-8-17(16(11-13)29(31)32)33-21-25-22-12-27(21)2/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | PBMMMADXGURAEH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|