C17H23ClN6O3S — CID 119543164
[4-(methylaminomethyl)piperidin-1-yl]-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride (PubChem CID 119543164) has the molecular formula C17H23ClN6O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is [4-(methylaminomethyl)piperidin-1-yl]-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride.
| Compound Name | [4-(methylaminomethyl)piperidin-1-yl]-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119543164 |
| Molecular Formula | C17H23ClN6O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [4-(methylaminomethyl)piperidin-1-yl]-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2ccc(Sc3nncn3C)c([N+](=O)[O-])c2)CC1.Cl |
| InChI | InChI=1S/C17H22N6O3S.ClH/c1-18-10-12-5-7-22(8-6-12)16(24)13-3-4-15(14(9-13)23(25)26)27-17-20-19-11-21(17)2;/h3-4,9,11-12,18H,5-8,10H2,1-2H3;1H |
| InChIKey | HZSXHLCGGWBAEP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|