C15H15N5O5S — CID 119366249
(2S)-1-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119366249) has the molecular formula C15H15N5O5S and a molecular weight of 377.38 g/mol. Its IUPAC name is (2S)-1-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119366249 |
| Molecular Formula | C15H15N5O5S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (2S)-1-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)N2CCC[C@H]2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O5S/c1-18-8-16-17-15(18)26-12-5-4-9(7-11(12)20(24)25)13(21)19-6-2-3-10(19)14(22)23/h4-5,7-8,10H,2-3,6H2,1H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | XDLUBMNXPGBYOH-JTQLQIEISA-N |
| XLogP | 1.56 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|