C19H24N6O4S — CID 55337758
[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55337758) has the molecular formula C19H24N6O4S and a molecular weight of 432.51 g/mol. Its IUPAC name is [4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55337758 |
| Molecular Formula | C19H24N6O4S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)N2CCN(CC3CCCO3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N6O4S/c1-22-13-20-21-19(22)30-17-5-4-14(11-16(17)25(27)28)18(26)24-8-6-23(7-9-24)12-15-3-2-10-29-15/h4-5,11,13,15H,2-3,6-10,12H2,1H3 |
| InChIKey | VYJUXIYSUDIHIT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|