C19H17N5O4S — CID 24508498
[3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]-phenylmethanone (PubChem CID 24508498) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is [3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]-phenylmethanone.
| Compound Name | [3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 24508498 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(Sc2nnnn2CC2CCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N5O4S/c25-18(13-5-2-1-3-6-13)14-8-9-17(16(11-14)24(26)27)29-19-20-21-22-23(19)12-15-7-4-10-28-15/h1-3,5-6,8-9,11,15H,4,7,10,12H2 |
| InChIKey | ADGRAOYVGVRVCB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|