C22H25N5O2S — CID 46672976
N-benzhydryl-N-methyl-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 46672976) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-benzhydryl-N-methyl-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-N-methyl-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46672976 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-benzhydryl-N-methyl-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CN(C(=O)CSc1nnnn1CC1CCCO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-26(21(17-9-4-2-5-10-17)18-11-6-3-7-12-18)20(28)16-30-22-23-24-25-27(22)15-19-13-8-14-29-19/h2-7,9-12,19,21H,8,13-16H2,1H3 |
| InChIKey | LFBJVYYOWPDKPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |