C14H23N5O2S — CID 127667265
1-(azepan-1-yl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 127667265) has the molecular formula C14H23N5O2S and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-(azepan-1-yl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 127667265 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(azepan-1-yl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | O=C(CSc1nnnn1CC1CCCO1)N1CCCCCC1 |
| InChI | InChI=1S/C14H23N5O2S/c20-13(18-7-3-1-2-4-8-18)11-22-14-15-16-17-19(14)10-12-6-5-9-21-12/h12H,1-11H2 |
| InChIKey | UGEIIDWXSQCYMW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |