C16H25N5O4S — CID 55429800
ethyl 1-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]piperidine-3-carboxylate (PubChem CID 55429800) has the molecular formula C16H25N5O4S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 1-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55429800 |
| Molecular Formula | C16H25N5O4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | ethyl 1-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CSc2nnnn2CC2CCCO2)C1 |
| InChI | InChI=1S/C16H25N5O4S/c1-2-24-15(23)12-5-3-7-20(9-12)14(22)11-26-16-17-18-19-21(16)10-13-6-4-8-25-13/h12-13H,2-11H2,1H3 |
| InChIKey | MSTVUSGXFDTDNB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |