C12H19N5O3S — CID 2359345
ethyl (3R)-1-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperidine-3-carboxylate (PubChem CID 2359345) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is ethyl (3R)-1-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 2359345 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl (3R)-1-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)CSc2nnnn2C)C1 |
| InChI | InChI=1S/C12H19N5O3S/c1-3-20-11(19)9-5-4-6-17(7-9)10(18)8-21-12-13-14-15-16(12)2/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | SKSRDZGMVCJFSO-SECBINFHSA-N |
| XLogP | 0.10 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |