C17H23NO3S — CID 78785099
ethyl 1-[2-(2-methylphenyl)sulfanylacetyl]piperidine-3-carboxylate (PubChem CID 78785099) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is ethyl 1-[2-(2-methylphenyl)sulfanylacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(2-methylphenyl)sulfanylacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78785099 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | ethyl 1-[2-(2-methylphenyl)sulfanylacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CSc2ccccc2C)C1 |
| InChI | InChI=1S/C17H23NO3S/c1-3-21-17(20)14-8-6-10-18(11-14)16(19)12-22-15-9-5-4-7-13(15)2/h4-5,7,9,14H,3,6,8,10-12H2,1-2H3 |
| InChIKey | NBGXRDSALCNNHQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |