C16H25ClN2OS — CID 119593816
1-[3-(1-aminoethyl)piperidin-1-yl]-2-(2-methylphenyl)sulfanylethanone;hydrochloride (PubChem CID 119593816) has the molecular formula C16H25ClN2OS and a molecular weight of 328.91 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-2-(2-methylphenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2-(2-methylphenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 119593816 |
| Molecular Formula | C16H25ClN2OS |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2-(2-methylphenyl)sulfanylethanone;hydrochloride |
| SMILES | Cc1ccccc1SCC(=O)N1CCCC(C(C)N)C1.Cl |
| InChI | InChI=1S/C16H24N2OS.ClH/c1-12-6-3-4-8-15(12)20-11-16(19)18-9-5-7-14(10-18)13(2)17;/h3-4,6,8,13-14H,5,7,9-11,17H2,1-2H3;1H |
| InChIKey | IAUJVICVJNLGDU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |