C24H33ClN2O — CID 119595280
1-[3-(1-aminoethyl)piperidin-1-yl]-3-benzyl-4-phenylbutan-1-one;hydrochloride (PubChem CID 119595280) has the molecular formula C24H33ClN2O and a molecular weight of 400.99 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-3-benzyl-4-phenylbutan-1-one;hydrochloride.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-3-benzyl-4-phenylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119595280 |
| Molecular Formula | C24H33ClN2O |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-3-benzyl-4-phenylbutan-1-one;hydrochloride |
| SMILES | CC(N)C1CCCN(C(=O)CC(Cc2ccccc2)Cc2ccccc2)C1.Cl |
| InChI | InChI=1S/C24H32N2O.ClH/c1-19(25)23-13-8-14-26(18-23)24(27)17-22(15-20-9-4-2-5-10-20)16-21-11-6-3-7-12-21;/h2-7,9-12,19,22-23H,8,13-18,25H2,1H3;1H |
| InChIKey | VCRXVWDCNQCQSM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |