C17H27ClN2O2S — CID 119594432
1-[3-(1-aminoethyl)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride (PubChem CID 119594432) has the molecular formula C17H27ClN2O2S and a molecular weight of 358.94 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 119594432 |
| Molecular Formula | C17H27ClN2O2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride |
| SMILES | CCOc1ccc(SCC(=O)N2CCCC(C(C)N)C2)cc1.Cl |
| InChI | InChI=1S/C17H26N2O2S.ClH/c1-3-21-15-6-8-16(9-7-15)22-12-17(20)19-10-4-5-14(11-19)13(2)18;/h6-9,13-14H,3-5,10-12,18H2,1-2H3;1H |
| InChIKey | XYGKIYPYYIPKRY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |