C17H25FN2OS — CID 119593716
1-[3-(1-aminoethyl)piperidin-1-yl]-3-(4-fluorophenyl)sulfanyl-2-methylpropan-1-one (PubChem CID 119593716) has the molecular formula C17H25FN2OS and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-3-(4-fluorophenyl)sulfanyl-2-methylpropan-1-one.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-3-(4-fluorophenyl)sulfanyl-2-methylpropan-1-one |
|---|---|
| PubChem CID | 119593716 |
| Molecular Formula | C17H25FN2OS |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-3-(4-fluorophenyl)sulfanyl-2-methylpropan-1-one |
| SMILES | CC(CSc1ccc(F)cc1)C(=O)N1CCCC(C(C)N)C1 |
| InChI | InChI=1S/C17H25FN2OS/c1-12(11-22-16-7-5-15(18)6-8-16)17(21)20-9-3-4-14(10-20)13(2)19/h5-8,12-14H,3-4,9-11,19H2,1-2H3 |
| InChIKey | YAGBJZUEJSXADG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |