C18H24N6O5S2 — CID 24508502
4-methyl-1-[3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]sulfonylpiperidine (PubChem CID 24508502) has the molecular formula C18H24N6O5S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-methyl-1-[3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]sulfonylpiperidine.
| Compound Name | 4-methyl-1-[3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 24508502 |
| Molecular Formula | C18H24N6O5S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-methyl-1-[3-nitro-4-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylphenyl]sulfonylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(Sc3nnnn3CC3CCCO3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H24N6O5S2/c1-13-6-8-22(9-7-13)31(27,28)15-4-5-17(16(11-15)24(25)26)30-18-19-20-21-23(18)12-14-3-2-10-29-14/h4-5,11,13-14H,2-3,6-10,12H2,1H3 |
| InChIKey | CGOKPGPSCHLZNI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|