C19H21N7O4S2 — CID 4841337
1-methyl-4-[4-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-3-nitrophenyl]sulfonylpiperazine (PubChem CID 4841337) has the molecular formula C19H21N7O4S2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 1-methyl-4-[4-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-3-nitrophenyl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[4-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-3-nitrophenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 4841337 |
| Molecular Formula | C19H21N7O4S2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-methyl-4-[4-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-3-nitrophenyl]sulfonylpiperazine |
| SMILES | Cc1ccccc1-n1nnnc1Sc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N7O4S2/c1-14-5-3-4-6-16(14)25-19(20-21-22-25)31-18-8-7-15(13-17(18)26(27)28)32(29,30)24-11-9-23(2)10-12-24/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | DGUSBUAAVQQIQF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|