C17H19N7O4S2 — CID 4841400
N-[2-(dimethylamino)ethyl]-3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzenesulfonamide (PubChem CID 4841400) has the molecular formula C17H19N7O4S2 and a molecular weight of 449.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 4841400 |
| Molecular Formula | C17H19N7O4S2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(Sc2nnnn2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N7O4S2/c1-22(2)11-10-18-30(27,28)14-8-9-16(15(12-14)24(25)26)29-17-19-20-21-23(17)13-6-4-3-5-7-13/h3-9,12,18H,10-11H2,1-2H3 |
| InChIKey | JJHLAKCNWXKGMA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|