C21H29N5O4S — CID 46443841
N-[2-(dimethylamino)ethyl]-3-nitro-4-[(1-phenylpyrrolidin-3-yl)methylamino]benzenesulfonamide (PubChem CID 46443841) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-nitro-4-[(1-phenylpyrrolidin-3-yl)methylamino]benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-nitro-4-[(1-phenylpyrrolidin-3-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 46443841 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-nitro-4-[(1-phenylpyrrolidin-3-yl)methylamino]benzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(NCC2CCN(c3ccccc3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H29N5O4S/c1-24(2)13-11-23-31(29,30)19-8-9-20(21(14-19)26(27)28)22-15-17-10-12-25(16-17)18-6-4-3-5-7-18/h3-9,14,17,22-23H,10-13,15-16H2,1-2H3 |
| InChIKey | SPZBOPCCCBUTLO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|