C20H26N4O4S — CID 9282816
N-[2-(dimethylamino)ethyl]-3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]benzenesulfonamide (PubChem CID 9282816) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 9282816 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]benzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(N[C@H]2CCCc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N4O4S/c1-23(2)13-12-21-29(27,28)16-10-11-19(20(14-16)24(25)26)22-18-9-5-7-15-6-3-4-8-17(15)18/h3-4,6,8,10-11,14,18,21-22H,5,7,9,12-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | HCPLGBGBHJQPPN-SFHVURJKSA-N |
| XLogP | 2.92 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|