C19H32N4O5S — CID 55393883
4-(3-cyclohexyloxypropylamino)-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 55393883) has the molecular formula C19H32N4O5S and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-(3-cyclohexyloxypropylamino)-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-(3-cyclohexyloxypropylamino)-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55393883 |
| Molecular Formula | C19H32N4O5S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-(3-cyclohexyloxypropylamino)-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(NCCCOC2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H32N4O5S/c1-22(2)13-12-21-29(26,27)17-9-10-18(19(15-17)23(24)25)20-11-6-14-28-16-7-4-3-5-8-16/h9-10,15-16,20-21H,3-8,11-14H2,1-2H3 |
| InChIKey | LEQYTZFKWJRWJF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|