C16H16N2O2 — CID 7410620
(1S)-N-(2-nitrophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 7410620) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (1S)-N-(2-nitrophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-N-(2-nitrophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 7410620 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (1S)-N-(2-nitrophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | O=[N+]([O-])c1ccccc1N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C16H16N2O2/c19-18(20)16-11-4-3-9-15(16)17-14-10-5-7-12-6-1-2-8-13(12)14/h1-4,6,8-9,11,14,17H,5,7,10H2/t14-/m0/s1 |
| InChIKey | GJIFPPCHXLRKHJ-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|