C19H21N3O3 — CID 51301434
4-(2,3-dihydro-1H-inden-1-ylamino)-3-nitro-N-propan-2-ylbenzamide (PubChem CID 51301434) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-1-ylamino)-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-1-ylamino)-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 51301434 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-1-ylamino)-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(NC2CCc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N3O3/c1-12(2)20-19(23)14-8-10-17(18(11-14)22(24)25)21-16-9-7-13-5-3-4-6-15(13)16/h3-6,8,10-12,16,21H,7,9H2,1-2H3,(H,20,23) |
| InChIKey | NJAMYYIGZUJYAE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|