C15H13ClN2O2S — CID 43232229
6-chloro-N-(2-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43232229) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 6-chloro-N-(2-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 6-chloro-N-(2-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43232229 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 6-chloro-N-(2-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | O=[N+]([O-])c1ccccc1NC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H13ClN2O2S/c16-10-5-6-15-11(9-10)12(7-8-21-15)17-13-3-1-2-4-14(13)18(19)20/h1-6,9,12,17H,7-8H2 |
| InChIKey | UJZXNNGWLHVWAL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|