C16H12ClFN2O3S — CID 51247332
4-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2-nitrobenzamide (PubChem CID 51247332) has the molecular formula C16H12ClFN2O3S and a molecular weight of 366.80 g/mol. Its IUPAC name is 4-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2-nitrobenzamide.
| Compound Name | 4-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 51247332 |
| Molecular Formula | C16H12ClFN2O3S |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 4-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2-nitrobenzamide |
| SMILES | O=C(NC1CCSc2ccc(F)cc21)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClFN2O3S/c17-9-1-3-11(14(7-9)20(22)23)16(21)19-13-5-6-24-15-4-2-10(18)8-12(13)15/h1-4,7-8,13H,5-6H2,(H,19,21) |
| InChIKey | FLQSRZXZQJLYOA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|