C16H13ClFNOS — CID 26468668
3-chloro-N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide (PubChem CID 26468668) has the molecular formula C16H13ClFNOS and a molecular weight of 321.80 g/mol. Its IUPAC name is 3-chloro-N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide.
| Compound Name | 3-chloro-N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide |
|---|---|
| PubChem CID | 26468668 |
| Molecular Formula | C16H13ClFNOS |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-chloro-N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide |
| SMILES | O=C(N[C@H]1CCSc2ccc(F)cc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClFNOS/c17-11-3-1-2-10(8-11)16(20)19-14-6-7-21-15-5-4-12(18)9-13(14)15/h1-5,8-9,14H,6-7H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | YQKRJYRTFAFVRA-AWEZNQCLSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |