About 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide
3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide (PubChem CID 24516450) has the molecular formula C17H14Cl2FNO2S
and a molecular weight of 386.28 g/mol. Its IUPAC name is 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide |
| PubChem CID | 24516450 |
| Molecular Formula | C17H14Cl2FNO2S |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC2CCSc3ccc(F)cc32)cc1Cl |
| InChI | InChI=1S/C17H14Cl2FNO2S/c1-23-16-12(18)6-9(7-13(16)19)17(22)21-14-4-5-24-15-3-2-10(20)8-11(14)15/h2-3,6-8,14H,4-5H2,1H3,(H,21,22) |
| InChIKey | GGZYNKZJDXJLDG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide?
The IUPAC name of 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide (CID 24516450) is 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide.
What is the SMILES notation for 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide?
The canonical SMILES for 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide is COc1c(Cl)cc(C(=O)NC2CCSc3ccc(F)cc32)cc1Cl.
What is the InChIKey of 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide?
The InChIKey is GGZYNKZJDXJLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2FNO2S/c1-23-16-12(18)6-9(7-13(16)19)17(22)21-14-4-5-24-15-3-2-10(20)8-11(14)15/h2-3,6-8,14H,4-5H2,1H3,(H,21,22).
What are the key properties of 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide?
3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide has a molecular weight of 386.28 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-methoxybenzamide is sourced from PubChem (CID 24516450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).