C15H12ClFN2OS — CID 60678283
2-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-3-carboxamide (PubChem CID 60678283) has the molecular formula C15H12ClFN2OS and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60678283 |
| Molecular Formula | C15H12ClFN2OS |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-chloro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCSc2ccc(F)cc21)c1cccnc1Cl |
| InChI | InChI=1S/C15H12ClFN2OS/c16-14-10(2-1-6-18-14)15(20)19-12-5-7-21-13-4-3-9(17)8-11(12)13/h1-4,6,8,12H,5,7H2,(H,19,20) |
| InChIKey | GCVOZZXNJMZYHB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|