C16H21FN2OS — CID 94453338
1-cyclohexyl-3-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]urea (PubChem CID 94453338) has the molecular formula C16H21FN2OS and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]urea |
|---|---|
| PubChem CID | 94453338 |
| Molecular Formula | C16H21FN2OS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-cyclohexyl-3-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]urea |
| SMILES | O=C(NC1CCCCC1)N[C@@H]1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C16H21FN2OS/c17-11-6-7-15-13(10-11)14(8-9-21-15)19-16(20)18-12-4-2-1-3-5-12/h6-7,10,12,14H,1-5,8-9H2,(H2,18,19,20)/t14-/m1/s1 |
| InChIKey | VFNFSBWJNCVEEL-CQSZACIVSA-N |
| XLogP | 3.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |