C12H10F5NOS — CID 103732268
2,2,3,3-tetrafluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)propanamide (PubChem CID 103732268) has the molecular formula C12H10F5NOS and a molecular weight of 311.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)propanamide |
|---|---|
| PubChem CID | 103732268 |
| Molecular Formula | C12H10F5NOS |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)propanamide |
| SMILES | O=C(NC1CCSc2ccc(F)cc21)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H10F5NOS/c13-6-1-2-9-7(5-6)8(3-4-20-9)18-11(19)12(16,17)10(14)15/h1-2,5,8,10H,3-4H2,(H,18,19) |
| InChIKey | BSALRWYMFVWJFQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|