C18H18FNOS — CID 26468741
4-ethyl-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide (PubChem CID 26468741) has the molecular formula C18H18FNOS and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-ethyl-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide.
| Compound Name | 4-ethyl-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide |
|---|---|
| PubChem CID | 26468741 |
| Molecular Formula | C18H18FNOS |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-ethyl-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]benzamide |
| SMILES | CCc1ccc(C(=O)N[C@@H]2CCSc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C18H18FNOS/c1-2-12-3-5-13(6-4-12)18(21)20-16-9-10-22-17-8-7-14(19)11-15(16)17/h3-8,11,16H,2,9-10H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | CLRLKEMJURXBAB-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |