C18H18FN3O3S — CID 42122207
N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(2-nitroanilino)propanamide (PubChem CID 42122207) has the molecular formula C18H18FN3O3S and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 42122207 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(2-nitroanilino)propanamide |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])N[C@@H]1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C18H18FN3O3S/c19-12-5-6-17-13(11-12)14(8-10-26-17)21-18(23)7-9-20-15-3-1-2-4-16(15)22(24)25/h1-6,11,14,20H,7-10H2,(H,21,23)/t14-/m1/s1 |
| InChIKey | BGQABVPWRYIHFJ-CQSZACIVSA-N |
| XLogP | 3.89 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|