C19H20ClN3O5S2 — CID 27306258
(4S)-6-chloro-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 27306258) has the molecular formula C19H20ClN3O5S2 and a molecular weight of 469.97 g/mol. Its IUPAC name is (4S)-6-chloro-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | (4S)-6-chloro-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 27306258 |
| Molecular Formula | C19H20ClN3O5S2 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | (4S)-6-chloro-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2CCSc3ccc(Cl)cc32)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H20ClN3O5S2/c20-13-1-4-18-15(11-13)16(5-10-29-18)21-17-3-2-14(23(24)25)12-19(17)30(26,27)22-6-8-28-9-7-22/h1-4,11-12,16,21H,5-10H2/t16-/m0/s1 |
| InChIKey | UBOFAETXSBGQPE-INIZCTEOSA-N |
| XLogP | 3.92 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|