C19H30N4O5S — CID 18144600
2,2,6,6-tetramethyl-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidin-4-amine (PubChem CID 18144600) has the molecular formula C19H30N4O5S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 18144600 |
| Molecular Formula | C19H30N4O5S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidin-4-amine |
| SMILES | CC1(C)CC(Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H30N4O5S/c1-18(2)12-14(13-19(3,4)21-18)20-16-6-5-15(23(24)25)11-17(16)29(26,27)22-7-9-28-10-8-22/h5-6,11,14,20-21H,7-10,12-13H2,1-4H3 |
| InChIKey | QNQVJDPQBFFVSO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|