C15H20N6O5S — CID 71923730
N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline (PubChem CID 71923730) has the molecular formula C15H20N6O5S and a molecular weight of 396.43 g/mol. Its IUPAC name is N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline.
| Compound Name | N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 71923730 |
| Molecular Formula | C15H20N6O5S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline |
| SMILES | Cc1nc(CCNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C15H20N6O5S/c1-11-17-15(19-18-11)4-5-16-13-3-2-12(21(22)23)10-14(13)27(24,25)20-6-8-26-9-7-20/h2-3,10,16H,4-9H2,1H3,(H,17,18,19) |
| InChIKey | OUXNZZRZBLBTHM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|