C16H21N5O5S — CID 75455191
N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline (PubChem CID 75455191) has the molecular formula C16H21N5O5S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 75455191 |
| Molecular Formula | C16H21N5O5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylsulfonyl-4-nitroaniline |
| SMILES | Cc1nn(C)cc1CNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H21N5O5S/c1-12-13(11-19(2)18-12)10-17-15-4-3-14(21(22)23)9-16(15)27(24,25)20-5-7-26-8-6-20/h3-4,9,11,17H,5-8,10H2,1-2H3 |
| InChIKey | PWDOOELYHMAMMT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|