C18H21N3O4S — CID 18190437
N-[(2-methylphenyl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 18190437) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[(2-methylphenyl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 18190437 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | Cc1ccccc1CNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C18H21N3O4S/c1-14-6-2-3-7-15(14)13-19-17-9-8-16(21(22)23)12-18(17)26(24,25)20-10-4-5-11-20/h2-3,6-9,12,19H,4-5,10-11,13H2,1H3 |
| InChIKey | GHNXKTQBXGATKG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|