C15H19N5O4S — CID 133270385
4-nitro-N-(2-pyrazol-1-ylethyl)-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 133270385) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is 4-nitro-N-(2-pyrazol-1-ylethyl)-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | 4-nitro-N-(2-pyrazol-1-ylethyl)-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133270385 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-nitro-N-(2-pyrazol-1-ylethyl)-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | O=[N+]([O-])c1ccc(NCCn2cccn2)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H19N5O4S/c21-20(22)13-4-5-14(16-7-11-18-8-3-6-17-18)15(12-13)25(23,24)19-9-1-2-10-19/h3-6,8,12,16H,1-2,7,9-11H2 |
| InChIKey | XDHDDCCBYWHQRA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|