C18H20N6O5S — CID 47069005
2-[2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 47069005) has the molecular formula C18H20N6O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 47069005 |
| Molecular Formula | C18H20N6O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(CCNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)nc2ccccn12 |
| InChI | InChI=1S/C18H20N6O5S/c25-18-22-11-2-1-5-17(22)20-23(18)12-8-19-15-7-6-14(24(26)27)13-16(15)30(28,29)21-9-3-4-10-21/h1-2,5-7,11,13,19H,3-4,8-10,12H2 |
| InChIKey | NRJYDPKGISVLPY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|