C16H25N3O6S — CID 18207941
N-[3-(2-methoxyethoxy)propyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 18207941) has the molecular formula C16H25N3O6S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 18207941 |
| Molecular Formula | C16H25N3O6S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | COCCOCCCNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C16H25N3O6S/c1-24-11-12-25-10-4-7-17-15-6-5-14(19(20)21)13-16(15)26(22,23)18-8-2-3-9-18/h5-6,13,17H,2-4,7-12H2,1H3 |
| InChIKey | LOAXWHBCNXQIQG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|