C24H32N4O5S — CID 71685553
N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 71685553) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 71685553 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | COc1ccc(C(CNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H32N4O5S/c1-33-21-10-7-19(8-11-21)23(26-13-3-2-4-14-26)18-25-22-12-9-20(28(29)30)17-24(22)34(31,32)27-15-5-6-16-27/h7-12,17,23,25H,2-6,13-16,18H2,1H3 |
| InChIKey | AREQXKKVLYDOIL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|