C22H24N4O4S — CID 4789527
N'-naphthalen-1-yl-N-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)ethane-1,2-diamine (PubChem CID 4789527) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N'-naphthalen-1-yl-N-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)ethane-1,2-diamine.
| Compound Name | N'-naphthalen-1-yl-N-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4789527 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N'-naphthalen-1-yl-N-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNc2cccc3ccccc23)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H24N4O4S/c27-26(28)18-10-11-21(22(16-18)31(29,30)25-14-3-4-15-25)24-13-12-23-20-9-5-7-17-6-1-2-8-19(17)20/h1-2,5-11,16,23-24H,3-4,12-15H2 |
| InChIKey | FFOGTMNIFAOHRG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|