C18H22N4O5S — CID 99794893
(2S)-2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-3-pyridin-2-ylpropan-1-ol (PubChem CID 99794893) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is (2S)-2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-3-pyridin-2-ylpropan-1-ol.
| Compound Name | (2S)-2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-3-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 99794893 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2S)-2-(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-3-pyridin-2-ylpropan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H](CO)Cc2ccccn2)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H22N4O5S/c23-13-15(11-14-5-1-2-8-19-14)20-17-7-6-16(22(24)25)12-18(17)28(26,27)21-9-3-4-10-21/h1-2,5-8,12,15,20,23H,3-4,9-11,13H2/t15-/m0/s1 |
| InChIKey | UNEIFYMYVZWGCB-HNNXBMFYSA-N |
| XLogP | 1.79 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|