C18H20ClN3O6S — CID 102557683
2-(3-chlorophenyl)-2-(2-morpholin-4-ylsulfonyl-4-nitroanilino)ethanol (PubChem CID 102557683) has the molecular formula C18H20ClN3O6S and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-(2-morpholin-4-ylsulfonyl-4-nitroanilino)ethanol.
| Compound Name | 2-(3-chlorophenyl)-2-(2-morpholin-4-ylsulfonyl-4-nitroanilino)ethanol |
|---|---|
| PubChem CID | 102557683 |
| Molecular Formula | C18H20ClN3O6S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-(3-chlorophenyl)-2-(2-morpholin-4-ylsulfonyl-4-nitroanilino)ethanol |
| SMILES | O=[N+]([O-])c1ccc(NC(CO)c2cccc(Cl)c2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H20ClN3O6S/c19-14-3-1-2-13(10-14)17(12-23)20-16-5-4-15(22(24)25)11-18(16)29(26,27)21-6-8-28-9-7-21/h1-5,10-11,17,20,23H,6-9,12H2 |
| InChIKey | WKQUYIKMLNJECE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|