C18H20FN3O4S — CID 34044359
N-[2-(3-fluorophenyl)ethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 34044359) has the molecular formula C18H20FN3O4S and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 34044359 |
| Molecular Formula | C18H20FN3O4S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | O=[N+]([O-])c1ccc(NCCc2cccc(F)c2)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H20FN3O4S/c19-15-5-3-4-14(12-15)8-9-20-17-7-6-16(22(23)24)13-18(17)27(25,26)21-10-1-2-11-21/h3-7,12-13,20H,1-2,8-11H2 |
| InChIKey | WCACWSQHMTYEOF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|