C17H22N3O2S+ — CID 9251559
N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9251559) has the molecular formula C17H22N3O2S+ and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9251559 |
| Molecular Formula | C17H22N3O2S+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | Cc1ccccc1CNc1ccc(S(=O)(=O)N2CCCC2)c[nH+]1 |
| InChI | InChI=1S/C17H21N3O2S/c1-14-6-2-3-7-15(14)12-18-17-9-8-16(13-19-17)23(21,22)20-10-4-5-11-20/h2-3,6-9,13H,4-5,10-12H2,1H3,(H,18,19)/p+1 |
| InChIKey | CHKJBMBMMGJKCS-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |