C16H19ClN3O2S+ — CID 9281567
N-[(2-chlorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9281567) has the molecular formula C16H19ClN3O2S+ and a molecular weight of 352.87 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9281567 |
| Molecular Formula | C16H19ClN3O2S+ |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | O=S(=O)(c1ccc(NCc2ccccc2Cl)[nH+]c1)N1CCCC1 |
| InChI | InChI=1S/C16H18ClN3O2S/c17-15-6-2-1-5-13(15)11-18-16-8-7-14(12-19-16)23(21,22)20-9-3-4-10-20/h1-2,5-8,12H,3-4,9-11H2,(H,18,19)/p+1 |
| InChIKey | QWXAXCMVKKFSQG-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |