C14H22N3O2S+ — CID 9282597
N-cyclopentyl-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9282597) has the molecular formula C14H22N3O2S+ and a molecular weight of 296.42 g/mol. Its IUPAC name is N-cyclopentyl-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-cyclopentyl-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9282597 |
| Molecular Formula | C14H22N3O2S+ |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-cyclopentyl-5-pyrrolidin-1-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | O=S(=O)(c1ccc(NC2CCCC2)[nH+]c1)N1CCCC1 |
| InChI | InChI=1S/C14H21N3O2S/c18-20(19,17-9-3-4-10-17)13-7-8-14(15-11-13)16-12-5-1-2-6-12/h7-8,11-12H,1-6,9-10H2,(H,15,16)/p+1 |
| InChIKey | RBOHOEVGDGCGEZ-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |